Відмінності між версіями «Амигдалін»

Перейти до навігації Перейти до пошуку
[неперевірена версія][неперевірена версія]
м (Перенесено 24 інтервікі-посилань до Вікіданих (Q410215))
{{chembox
[[Файл:Amygdalin skeletal.png|міні|]]
| Verifiedfields = changed
| verifiedrevid = 477175041
|ImageFile=Amygdalin structure.svg
|ImageSize=250px
|ImageFile2=Amygdalin-from-xtal-3D-balls.png
|ImageSize2=220px
|IUPACName= [(6-''O''-β-<small>D</small>-glucopyranosyl-β-<small>D</small>-glucopyranosyl)oxy](phenyl)acetonitrile
|OtherNames=
|Section1= {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 570897
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 461727
| InChI = 1/C20H27NO11/c21-6-10(9-4-2-1-3-5-9)30-20-18(28)16(26)14(24)12(32-20)8-29-19-17(27)15(25)13(23)11(7-22)31-19/h1-5,10-20,22-28H,7-8H2/t10-,11+,12+,13+,14+,15-,16-,17+,18+,19+,20+/m0/s1
| InChIKey = XUCIJNAGGSZNQT-JHSLDZJXBT
| SMILES1 = N#C[C@H](O[C@@H]2O[C@H](CO[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)[C@@H](O)[C@H](O)[C@H]2O)c3ccccc3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H27NO11/c21-6-10(9-4-2-1-3-5-9)30-20-18(28)16(26)14(24)12(32-20)8-29-19-17(27)15(25)13(23)11(7-22)31-19/h1-5,10-20,22-28H,7-8H2/t10-,11+,12+,13+,14+,15-,16-,17+,18+,19+,20+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XUCIJNAGGSZNQT-JHSLDZJXSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo=29883-15-6
| PubChem=34751
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 214UUQ9N0H
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17019
| SMILES=O[C@@H]3[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]3OC[C@H]2O[C@@H](OC(C#N)c1ccccc1)[C@H](O)[C@@H](O)[C@@H]2O
| MeSHName=Amygdalin
}}
|Section2= {{Chembox Properties
|C=20|H=27|N=1|O=11
| MolarMass=457.429
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3= {{Chembox Hazards
| NFPA-H = 1
| NFPA-F = 0
| NFPA-R = 0
| MainHazards=
| FlashPt=
| Autoignition=
}}
| Section8 = {{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunctn =
| Function =
| OtherCpds = [[vicianin]], [[laetrile]] }}
}}
 
'''Амигдали́н''' (від {{lang-el|ἀμυγδάλη}} - [[мигдаль]]) — генцібіозід [[нітрил|нітрилу]] мигдальної кислоти C<sub>20</sub>H<sub>27</sub>O<sub>11</sub>N * 3H<sub>2</sub>O, [[глікозид]], що міститься в кісточках багатьох рослин роду [[Слива домашня|слив]] (''Prunus''), надаючи їм гіркого смаку. Вперше виділений з гіркого мигдалю ''Prunus amygdalus var. amara''. Ромбічні кристали з температурою плавління 215&nbsp;°C.