
Матеріал з Вікіпедії — вільної енциклопедії.
Перейти до навігації Перейти до пошуку
Назва за IUPAC 3-({3-[(2S)-2-Amino-2-carboxyethyl]-5-methyl-2,6-dioxo-3,6-dihydro-1(2H)-pyrimidinyl}methyl)-2-thiophenecarboxylic acid
PubChem 6420160
Назва MeSH UBP310
SMILES O=C(O)[C@@H](N)CN/1C(=O)N(C(=O)\C(=C\1)C)Cc2c(scc2)C(=O)O
InChI 1S/C14H15N3O6S/c1-7-4-16(6-9(15)12(19)20)14(23)17(11(7)18)5-8-2-3-24-10(8)13(21)22/h2-4,9H,5-6,15H2,1H3,(H,19,20)(H,21,22)/t9-/m0/s1[1]
Молекулярна формула C14H15N3O6S
Молярна маса 353,35
Зовнішній вигляд Білий порошок
Густина 1,564 г/см3
Тпл 330,21 °C
Ткип 615,153 °C
Розчинність (вода) 231,9 мг/л
Кислотність (pKa) 2,118
Температура спалаху 325,833 °C
Якщо не зазначено інше, дані приведені для речовин у стандартному стані (за 25 °C, 100 кПа)
Інструкція з використання шаблону
Примітки картки

UBP310 (3-({3-[(2S)-2-Amino-2-carboxyethyl]-5-methyl-2,6-dioxo-3,6-dihydro-1(2H)-pyrimidinyl}methyl)-2-thiophenecarboxylic acid) — високоселективний конкурентний антагоніст субодиниці GluR5 каїнатних рецепторів (ІС50 = 130 nM). Окрім того, може зв'язуватись з субодиницею GluR7 каїнатних та GluR2 АМРА-рецепторів, також виявляючи антагоністичні властивості, але набагато слабкіші.

Джерела[ред. | ред. код]

  1. CHEMBL373428